C18H19N3O — CID 71263683
N-cyclohexyl-2-phenyl-[1,3]oxazolo[5,4-b]pyridin-5-amine (PubChem CID 71263683) has the molecular formula C18H19N3O and a molecular weight of 293.37 g/mol. Its IUPAC name is N-cyclohexyl-2-phenyl-[1,3]oxazolo[5,4-b]pyridin-5-amine.
| Compound Name | N-cyclohexyl-2-phenyl-[1,3]oxazolo[5,4-b]pyridin-5-amine |
|---|---|
| PubChem CID | 71263683 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | N-cyclohexyl-2-phenyl-[1,3]oxazolo[5,4-b]pyridin-5-amine |
| SMILES | c1ccc(-c2nc3ccc(NC4CCCCC4)nc3o2)cc1 |
| InChI | InChI=1S/C18H19N3O/c1-3-7-13(8-4-1)17-20-15-11-12-16(21-18(15)22-17)19-14-9-5-2-6-10-14/h1,3-4,7-8,11-12,14H,2,5-6,9-10H2,(H,19,21) |
| InChIKey | YEVDDJQQSVGUIQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |