About 3-Tert-butyl-5-ethyl-4-(trifluoromethyl)-1,2-oxazole
3-Tert-butyl-5-ethyl-4-(trifluoromethyl)-1,2-oxazole (PubChem CID 71263687) has the molecular formula C10H14F3NO
and a molecular weight of 221.22 g/mol. Its IUPAC name is 3-tert-butyl-5-ethyl-4-(trifluoromethyl)-1,2-oxazole.
Molecular Properties
| Compound Name | 3-Tert-butyl-5-ethyl-4-(trifluoromethyl)-1,2-oxazole |
| PubChem CID | 71263687 |
| Molecular Formula | C10H14F3NO |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 3-tert-butyl-5-ethyl-4-(trifluoromethyl)-1,2-oxazole |
| SMILES | CCC1=C(C(=NO1)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C10H14F3NO/c1-5-6-7(10(11,12)13)8(14-15-6)9(2,3)4/h5H2,1-4H3 |
| InChIKey | LVSMEHZCSPSADL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 26.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | 222 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-Tert-butyl-5-ethyl-4-(trifluoromethyl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-Tert-butyl-5-ethyl-4-(trifluoromethyl)-1,2-oxazole?
The IUPAC name of 3-Tert-butyl-5-ethyl-4-(trifluoromethyl)-1,2-oxazole (CID 71263687) is 3-tert-butyl-5-ethyl-4-(trifluoromethyl)-1,2-oxazole.
What is the SMILES notation for 3-Tert-butyl-5-ethyl-4-(trifluoromethyl)-1,2-oxazole?
The canonical SMILES for 3-Tert-butyl-5-ethyl-4-(trifluoromethyl)-1,2-oxazole is CCC1=C(C(=NO1)C(C)(C)C)C(F)(F)F.
What is the InChIKey of 3-Tert-butyl-5-ethyl-4-(trifluoromethyl)-1,2-oxazole?
The InChIKey is LVSMEHZCSPSADL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3NO/c1-5-6-7(10(11,12)13)8(14-15-6)9(2,3)4/h5H2,1-4H3.
What are the key properties of 3-Tert-butyl-5-ethyl-4-(trifluoromethyl)-1,2-oxazole?
3-Tert-butyl-5-ethyl-4-(trifluoromethyl)-1,2-oxazole has a molecular weight of 221.22 g/mol, XLogP of 3.80, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-Tert-butyl-5-ethyl-4-(trifluoromethyl)-1,2-oxazole is sourced from PubChem (CID 71263687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).