C22H26F3N5O2 — CID 71264090
13-[4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]cyclohexyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-10,12-dione (PubChem CID 71264090) has the molecular formula C22H26F3N5O2 and a molecular weight of 449.48 g/mol. Its IUPAC name is 13-[4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]cyclohexyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-10,12-dione.
| Compound Name | 13-[4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]cyclohexyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-10,12-dione |
|---|---|
| PubChem CID | 71264090 |
| Molecular Formula | C22H26F3N5O2 |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 13-[4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]cyclohexyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-10,12-dione |
| SMILES | O=c1[nH]c(=O)n(C2CCC(CN3CCC(C(F)(F)F)CC3)CC2)c2c1cnc1[nH]ccc12 |
| InChI | InChI=1S/C22H26F3N5O2/c23-22(24,25)14-6-9-29(10-7-14)12-13-1-3-15(4-2-13)30-18-16-5-8-26-19(16)27-11-17(18)20(31)28-21(30)32/h5,8,11,13-15H,1-4,6-7,9-10,12H2,(H,26,27)(H,28,31,32) |
| InChIKey | UYDIAFXSWPRAOU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 86.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |