C21H23N5O3S — CID 71264195
13-(1-benzylsulfonylpiperidin-4-yl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one (PubChem CID 71264195) has the molecular formula C21H23N5O3S and a molecular weight of 425.51 g/mol. Its IUPAC name is 13-(1-benzylsulfonylpiperidin-4-yl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one.
| Compound Name | 13-(1-benzylsulfonylpiperidin-4-yl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
|---|---|
| PubChem CID | 71264195 |
| Molecular Formula | C21H23N5O3S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 13-(1-benzylsulfonylpiperidin-4-yl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
| SMILES | O=C1NCc2cnc3[nH]ccc3c2N1C1CCN(S(=O)(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H23N5O3S/c27-21-24-13-16-12-23-20-18(6-9-22-20)19(16)26(21)17-7-10-25(11-8-17)30(28,29)14-15-4-2-1-3-5-15/h1-6,9,12,17H,7-8,10-11,13-14H2,(H,22,23)(H,24,27) |
| InChIKey | AHNVVSPIZGBJPS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 98.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |