About CID 71264415
CID 71264415 (PubChem CID 71264415) has the molecular formula C28H32F3NO4
and a molecular weight of 503.56 g/mol.
Molecular Properties
| Compound Name | CID 71264415 |
| PubChem CID | 71264415 |
| Molecular Formula | C28H32F3NO4 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | — |
| SMILES | COc1cc([C@H]2OC3(CCOCC3)c3c2c(C(C)C)nc2c3[C@@H](O)CC3(CC3)C2)ccc1C(F)(F)F |
| InChI | InChI=1S/C28H32F3NO4/c1-15(2)24-22-23(21-18(32-24)13-26(6-7-26)14-19(21)33)27(8-10-35-11-9-27)36-25(22)16-4-5-17(28(29,30)31)20(12-16)34-3/h4-5,12,15,19,25,33H,6-11,13-14H2,1-3H3/t19-,25+/m0/s1 |
| InChIKey | OZZDLODZCODVQC-UQBPGWFLSA-N |
| XLogP | 6.12 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 71264415 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71264415?
The IUPAC name of CID 71264415 (CID 71264415) is not available.
What is the SMILES notation for CID 71264415?
The canonical SMILES for CID 71264415 is COc1cc([C@H]2OC3(CCOCC3)c3c2c(C(C)C)nc2c3[C@@H](O)CC3(CC3)C2)ccc1C(F)(F)F.
What is the InChIKey of CID 71264415?
The InChIKey is OZZDLODZCODVQC-UQBPGWFLSA-N. The full InChI is InChI=1S/C28H32F3NO4/c1-15(2)24-22-23(21-18(32-24)13-26(6-7-26)14-19(21)33)27(8-10-35-11-9-27)36-25(22)16-4-5-17(28(29,30)31)20(12-16)34-3/h4-5,12,15,19,25,33H,6-11,13-14H2,1-3H3/t19-,25+/m0/s1.
What are the key properties of CID 71264415?
CID 71264415 has a molecular weight of 503.56 g/mol, XLogP of 6.12, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71264415 is sourced from PubChem (CID 71264415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).