C24H29F3N6O3S — CID 71264479
(1R,2R,3S)-3-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2-fluoro-5-(2-hydroxypropan-2-yloxy)cyclopentan-1-ol (PubChem CID 71264479) has the molecular formula C24H29F3N6O3S and a molecular weight of 538.60 g/mol. Its IUPAC name is (1R,2R,3S)-3-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2-fluoro-5-(2-hydroxypropan-2-yloxy)cyclopentan-1-ol.
| Compound Name | (1R,2R,3S)-3-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2-fluoro-5-(2-hydroxypropan-2-yloxy)cyclopentan-1-ol |
|---|---|
| PubChem CID | 71264479 |
| Molecular Formula | C24H29F3N6O3S |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | (1R,2R,3S)-3-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-2-fluoro-5-(2-hydroxypropan-2-yloxy)cyclopentan-1-ol |
| SMILES | CCCSc1nc(N[C@@H]2C[C@H]2c2ccc(F)c(F)c2)c2nnn([C@H]3CC(OC(C)(C)O)[C@@H](O)[C@@H]3F)c2n1 |
| InChI | InChI=1S/C24H29F3N6O3S/c1-4-7-37-23-29-21(28-15-9-12(15)11-5-6-13(25)14(26)8-11)19-22(30-23)33(32-31-19)16-10-17(20(34)18(16)27)36-24(2,3)35/h5-6,8,12,15-18,20,34-35H,4,7,9-10H2,1-3H3,(H,28,29,30)/t12-,15+,16-,17?,18+,20+/m0/s1 |
| InChIKey | BPQUTNKSYHAZSX-DJBQAZOASA-N |
| XLogP | 3.73 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|