C24H30F2N6O5S — CID 71264539
(1S,2S,3R,5S)-3-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-5-(2,3-dihydroxypropoxy)cyclopentane-1,2-diol (PubChem CID 71264539) has the molecular formula C24H30F2N6O5S and a molecular weight of 552.60 g/mol. Its IUPAC name is (1S,2S,3R,5S)-3-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-5-(2,3-dihydroxypropoxy)cyclopentane-1,2-diol.
| Compound Name | (1S,2S,3R,5S)-3-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-5-(2,3-dihydroxypropoxy)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 71264539 |
| Molecular Formula | C24H30F2N6O5S |
| Molecular Weight | 552.60 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | (1S,2S,3R,5S)-3-[7-[[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]amino]-5-propylsulfanyltriazolo[4,5-d]pyrimidin-3-yl]-5-(2,3-dihydroxypropoxy)cyclopentane-1,2-diol |
| SMILES | CCCSc1nc(N[C@@H]2C[C@H]2c2ccc(F)c(F)c2)c2nnn([C@@H]3C[C@H](OCC(O)CO)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C24H30F2N6O5S/c1-2-5-38-24-28-22(27-16-7-13(16)11-3-4-14(25)15(26)6-11)19-23(29-24)32(31-30-19)17-8-18(21(36)20(17)35)37-10-12(34)9-33/h3-4,6,12-13,16-18,20-21,33-36H,2,5,7-10H2,1H3,(H,27,28,29)/t12?,13-,16+,17+,18-,20-,21+/m0/s1 |
| InChIKey | PDKXOVMOLXKMOG-HRXYOTLZSA-N |
| XLogP | 1.37 |
| TPSA | 158.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.60 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |