C23H34FNO6 — CID 71264562
benzyl N-[(4S,6R,6aS)-4-(3-butoxy-2-fluoropropoxy)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]carbamate (PubChem CID 71264562) has the molecular formula C23H34FNO6 and a molecular weight of 439.52 g/mol. Its IUPAC name is benzyl N-[(4S,6R,6aS)-4-(3-butoxy-2-fluoropropoxy)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]carbamate.
| Compound Name | benzyl N-[(4S,6R,6aS)-4-(3-butoxy-2-fluoropropoxy)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]carbamate |
|---|---|
| PubChem CID | 71264562 |
| Molecular Formula | C23H34FNO6 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | benzyl N-[(4S,6R,6aS)-4-(3-butoxy-2-fluoropropoxy)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]carbamate |
| SMILES | CCCCOCC(F)CO[C@H]1C[C@@H](NC(=O)OCc2ccccc2)[C@@H]2OC(C)(C)OC12 |
| InChI | InChI=1S/C23H34FNO6/c1-4-5-11-27-14-17(24)15-28-19-12-18(20-21(19)31-23(2,3)30-20)25-22(26)29-13-16-9-7-6-8-10-16/h6-10,17-21H,4-5,11-15H2,1-3H3,(H,25,26)/t17?,18-,19+,20+,21?/m1/s1 |
| InChIKey | PVYAMQPTWFMFJP-XUPOMNEHSA-N |
| XLogP | 3.75 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|