C20H23ClN3O3+ — CID 7126525
2-(4-chlorophenoxy)-N-[2-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]acetamide (PubChem CID 7126525) has the molecular formula C20H23ClN3O3+ and a molecular weight of 388.88 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[2-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[2-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 7126525 |
| Molecular Formula | C20H23ClN3O3+ |
| Molecular Weight | 388.88 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[2-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]acetamide |
| SMILES | C[NH+]1CCN(C(=O)c2ccccc2NC(=O)COc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H22ClN3O3/c1-23-10-12-24(13-11-23)20(26)17-4-2-3-5-18(17)22-19(25)14-27-16-8-6-15(21)7-9-16/h2-9H,10-14H2,1H3,(H,22,25)/p+1 |
| InChIKey | CYRGINWVXSPJKH-UHFFFAOYSA-O |
| XLogP | 1.33 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.88 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |