About [(1R)-1-(3-fluorophenyl)ethyl] N-(5-ethyl-3-methyl-1,2-thiazol-4-yl)carbamate
[(1R)-1-(3-fluorophenyl)ethyl] N-(5-ethyl-3-methyl-1,2-thiazol-4-yl)carbamate (PubChem CID 71265465) has the molecular formula C15H17FN2O2S
and a molecular weight of 308.38 g/mol. Its IUPAC name is [(1R)-1-(3-fluorophenyl)ethyl] N-(5-ethyl-3-methyl-1,2-thiazol-4-yl)carbamate.
Molecular Properties
| Compound Name | [(1R)-1-(3-fluorophenyl)ethyl] N-(5-ethyl-3-methyl-1,2-thiazol-4-yl)carbamate |
| PubChem CID | 71265465 |
| Molecular Formula | C15H17FN2O2S |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | [(1R)-1-(3-fluorophenyl)ethyl] N-(5-ethyl-3-methyl-1,2-thiazol-4-yl)carbamate |
| SMILES | CCc1snc(C)c1NC(=O)O[C@H](C)c1cccc(F)c1 |
| InChI | InChI=1S/C15H17FN2O2S/c1-4-13-14(9(2)18-21-13)17-15(19)20-10(3)11-6-5-7-12(16)8-11/h5-8,10H,4H2,1-3H3,(H,17,19)/t10-/m1/s1 |
| InChIKey | KKTZFYUAGMCXEO-SNVBAGLBSA-N |
| XLogP | 4.46 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1R)-1-(3-fluorophenyl)ethyl] N-(5-ethyl-3-methyl-1,2-thiazol-4-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-(3-fluorophenyl)ethyl] N-(5-ethyl-3-methyl-1,2-thiazol-4-yl)carbamate?
The IUPAC name of [(1R)-1-(3-fluorophenyl)ethyl] N-(5-ethyl-3-methyl-1,2-thiazol-4-yl)carbamate (CID 71265465) is [(1R)-1-(3-fluorophenyl)ethyl] N-(5-ethyl-3-methyl-1,2-thiazol-4-yl)carbamate.
What is the SMILES notation for [(1R)-1-(3-fluorophenyl)ethyl] N-(5-ethyl-3-methyl-1,2-thiazol-4-yl)carbamate?
The canonical SMILES for [(1R)-1-(3-fluorophenyl)ethyl] N-(5-ethyl-3-methyl-1,2-thiazol-4-yl)carbamate is CCc1snc(C)c1NC(=O)O[C@H](C)c1cccc(F)c1.
What is the InChIKey of [(1R)-1-(3-fluorophenyl)ethyl] N-(5-ethyl-3-methyl-1,2-thiazol-4-yl)carbamate?
The InChIKey is KKTZFYUAGMCXEO-SNVBAGLBSA-N. The full InChI is InChI=1S/C15H17FN2O2S/c1-4-13-14(9(2)18-21-13)17-15(19)20-10(3)11-6-5-7-12(16)8-11/h5-8,10H,4H2,1-3H3,(H,17,19)/t10-/m1/s1.
What are the key properties of [(1R)-1-(3-fluorophenyl)ethyl] N-(5-ethyl-3-methyl-1,2-thiazol-4-yl)carbamate?
[(1R)-1-(3-fluorophenyl)ethyl] N-(5-ethyl-3-methyl-1,2-thiazol-4-yl)carbamate has a molecular weight of 308.38 g/mol, XLogP of 4.46, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-(3-fluorophenyl)ethyl] N-(5-ethyl-3-methyl-1,2-thiazol-4-yl)carbamate is sourced from PubChem (CID 71265465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).