About 2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-4,5-dihydropyrimidin-6-amine
2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-4,5-dihydropyrimidin-6-amine (PubChem CID 71267211) has the molecular formula C11H10FN5
and a molecular weight of 231.23 g/mol. Its IUPAC name is 2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-4,5-dihydropyrimidin-6-amine.
Molecular Properties
| Compound Name | 2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-4,5-dihydropyrimidin-6-amine |
| PubChem CID | 71267211 |
| Molecular Formula | C11H10FN5 |
| Molecular Weight | 231.23 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-4,5-dihydropyrimidin-6-amine |
| SMILES | NC1=NC(c2c[nH]c3ncc(F)cc23)=NCC1 |
| InChI | InChI=1S/C11H10FN5/c12-6-3-7-8(5-16-10(7)15-4-6)11-14-2-1-9(13)17-11/h3-5H,1-2H2,(H,15,16)(H2,13,14,17) |
| InChIKey | XCYZINZLDNATPH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-4,5-dihydropyrimidin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-4,5-dihydropyrimidin-6-amine?
The IUPAC name of 2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-4,5-dihydropyrimidin-6-amine (CID 71267211) is 2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-4,5-dihydropyrimidin-6-amine.
What is the SMILES notation for 2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-4,5-dihydropyrimidin-6-amine?
The canonical SMILES for 2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-4,5-dihydropyrimidin-6-amine is NC1=NC(c2c[nH]c3ncc(F)cc23)=NCC1.
What is the InChIKey of 2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-4,5-dihydropyrimidin-6-amine?
The InChIKey is XCYZINZLDNATPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FN5/c12-6-3-7-8(5-16-10(7)15-4-6)11-14-2-1-9(13)17-11/h3-5H,1-2H2,(H,15,16)(H2,13,14,17).
What are the key properties of 2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-4,5-dihydropyrimidin-6-amine?
2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-4,5-dihydropyrimidin-6-amine has a molecular weight of 231.23 g/mol, XLogP of 1.21, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)-4,5-dihydropyrimidin-6-amine is sourced from PubChem (CID 71267211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).