C28H28Cl2N4O4 — CID 71267459
6-[(5-butoxy-2-chlorobenzoyl)amino]-N-(3-chloro-2-methylphenyl)-2-(methoxymethyl)-1H-benzimidazole-4-carboxamide (PubChem CID 71267459) has the molecular formula C28H28Cl2N4O4 and a molecular weight of 555.46 g/mol. Its IUPAC name is 6-[(5-butoxy-2-chlorobenzoyl)amino]-N-(3-chloro-2-methylphenyl)-2-(methoxymethyl)-1H-benzimidazole-4-carboxamide.
| Compound Name | 6-[(5-butoxy-2-chlorobenzoyl)amino]-N-(3-chloro-2-methylphenyl)-2-(methoxymethyl)-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 71267459 |
| Molecular Formula | C28H28Cl2N4O4 |
| Molecular Weight | 555.46 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | 6-[(5-butoxy-2-chlorobenzoyl)amino]-N-(3-chloro-2-methylphenyl)-2-(methoxymethyl)-1H-benzimidazole-4-carboxamide |
| SMILES | CCCCOc1ccc(Cl)c(C(=O)Nc2cc(C(=O)Nc3cccc(Cl)c3C)c3nc(COC)[nH]c3c2)c1 |
| InChI | InChI=1S/C28H28Cl2N4O4/c1-4-5-11-38-18-9-10-22(30)19(14-18)27(35)31-17-12-20(26-24(13-17)32-25(34-26)15-37-3)28(36)33-23-8-6-7-21(29)16(23)2/h6-10,12-14H,4-5,11,15H2,1-3H3,(H,31,35)(H,32,34)(H,33,36) |
| InChIKey | OCCMYFBHIWSCFQ-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.46 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|