C28H23N3O7 — CID 71267614
[(2R,4R)-2-azido-4-[(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methoxy]cyclohexyl] benzoate (PubChem CID 71267614) has the molecular formula C28H23N3O7 and a molecular weight of 513.51 g/mol. Its IUPAC name is [(2R,4R)-2-azido-4-[(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methoxy]cyclohexyl] benzoate.
| Compound Name | [(2R,4R)-2-azido-4-[(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methoxy]cyclohexyl] benzoate |
|---|---|
| PubChem CID | 71267614 |
| Molecular Formula | C28H23N3O7 |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | [(2R,4R)-2-azido-4-[(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)methoxy]cyclohexyl] benzoate |
| SMILES | [N-]=[N+]=N[C@@H]1C[C@H](OCc2cc(O)c3c(c2)C(=O)c2cccc(O)c2C3=O)CCC1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H23N3O7/c29-31-30-20-13-17(9-10-23(20)38-28(36)16-5-2-1-3-6-16)37-14-15-11-19-25(22(33)12-15)27(35)24-18(26(19)34)7-4-8-21(24)32/h1-8,11-12,17,20,23,32-33H,9-10,13-14H2/t17-,20-,23?/m1/s1 |
| InChIKey | QOSCSFVHCATMMY-NDIGNCCYSA-N |
| XLogP | 4.85 |
| TPSA | 158.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|