C16H24O13 — CID 71267653
[(2R,3R,4S,5R,6R)-6-ethoxy-3,4,5-tris(methoxycarbonyloxy)oxan-2-yl]methyl acetate (PubChem CID 71267653) has the molecular formula C16H24O13 and a molecular weight of 424.36 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-6-ethoxy-3,4,5-tris(methoxycarbonyloxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-6-ethoxy-3,4,5-tris(methoxycarbonyloxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71267653 |
| Molecular Formula | C16H24O13 |
| Molecular Weight | 424.36 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-6-ethoxy-3,4,5-tris(methoxycarbonyloxy)oxan-2-yl]methyl acetate |
| SMILES | CCO[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(=O)OC)[C@H](OC(=O)OC)[C@H]1OC(=O)OC |
| InChI | InChI=1S/C16H24O13/c1-6-24-13-12(29-16(20)23-5)11(28-15(19)22-4)10(27-14(18)21-3)9(26-13)7-25-8(2)17/h9-13H,6-7H2,1-5H3/t9-,10-,11+,12-,13-/m1/s1 |
| InChIKey | UQOKQXMYDJYTNC-UJPOAAIJSA-N |
| XLogP | 0.77 |
| TPSA | 151.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.36 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|