C32H33Cl2FN4O4 — CID 71267870
(2S)-2-[2-[(2,3-dichlorophenyl)methylcarbamoyl]-7-(8-fluoro-5-methyl-3,4-dihydro-2H-chromen-6-yl)-5-methylpyrazolo[1,5-a]pyrimidin-6-yl]-4,4-dimethylpentanoic acid (PubChem CID 71267870) has the molecular formula C32H33Cl2FN4O4 and a molecular weight of 627.54 g/mol. Its IUPAC name is (2S)-2-[2-[(2,3-dichlorophenyl)methylcarbamoyl]-7-(8-fluoro-5-methyl-3,4-dihydro-2H-chromen-6-yl)-5-methylpyrazolo[1,5-a]pyrimidin-6-yl]-4,4-dimethylpentanoic acid.
| Compound Name | (2S)-2-[2-[(2,3-dichlorophenyl)methylcarbamoyl]-7-(8-fluoro-5-methyl-3,4-dihydro-2H-chromen-6-yl)-5-methylpyrazolo[1,5-a]pyrimidin-6-yl]-4,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 71267870 |
| Molecular Formula | C32H33Cl2FN4O4 |
| Molecular Weight | 627.54 g/mol |
| Exact Mass | 626.19 |
| IUPAC Name | (2S)-2-[2-[(2,3-dichlorophenyl)methylcarbamoyl]-7-(8-fluoro-5-methyl-3,4-dihydro-2H-chromen-6-yl)-5-methylpyrazolo[1,5-a]pyrimidin-6-yl]-4,4-dimethylpentanoic acid |
| SMILES | Cc1nc2cc(C(=O)NCc3cccc(Cl)c3Cl)nn2c(-c2cc(F)c3c(c2C)CCCO3)c1[C@H](CC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C32H33Cl2FN4O4/c1-16-19-9-7-11-43-29(19)23(35)12-20(16)28-26(21(31(41)42)14-32(3,4)5)17(2)37-25-13-24(38-39(25)28)30(40)36-15-18-8-6-10-22(33)27(18)34/h6,8,10,12-13,21H,7,9,11,14-15H2,1-5H3,(H,36,40)(H,41,42)/t21-/m0/s1 |
| InChIKey | XPDBBKAMIMGUSZ-NRFANRHFSA-N |
| XLogP | 7.32 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.54 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |