About 1-[2-[2-(2,3-dimethyl-2H-imidazol-1-yl)ethoxy]ethyl]-2,3-dimethyl-2H-imidazole
1-[2-[2-(2,3-dimethyl-2H-imidazol-1-yl)ethoxy]ethyl]-2,3-dimethyl-2H-imidazole (PubChem CID 71268064) has the molecular formula C14H26N4O
and a molecular weight of 266.39 g/mol. Its IUPAC name is 1-[2-[2-(2,3-dimethyl-2H-imidazol-1-yl)ethoxy]ethyl]-2,3-dimethyl-2H-imidazole.
Molecular Properties
| Compound Name | 1-[2-[2-(2,3-dimethyl-2H-imidazol-1-yl)ethoxy]ethyl]-2,3-dimethyl-2H-imidazole |
| PubChem CID | 71268064 |
| Molecular Formula | C14H26N4O |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | 1-[2-[2-(2,3-dimethyl-2H-imidazol-1-yl)ethoxy]ethyl]-2,3-dimethyl-2H-imidazole |
| SMILES | CC1N(C)C=CN1CCOCCN1C=CN(C)C1C |
| InChI | InChI=1S/C14H26N4O/c1-13-15(3)5-7-17(13)9-11-19-12-10-18-8-6-16(4)14(18)2/h5-8,13-14H,9-12H2,1-4H3 |
| InChIKey | MVAQNQVCCABEIV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 22.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[2-(2,3-dimethyl-2H-imidazol-1-yl)ethoxy]ethyl]-2,3-dimethyl-2H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[2-(2,3-dimethyl-2H-imidazol-1-yl)ethoxy]ethyl]-2,3-dimethyl-2H-imidazole?
The IUPAC name of 1-[2-[2-(2,3-dimethyl-2H-imidazol-1-yl)ethoxy]ethyl]-2,3-dimethyl-2H-imidazole (CID 71268064) is 1-[2-[2-(2,3-dimethyl-2H-imidazol-1-yl)ethoxy]ethyl]-2,3-dimethyl-2H-imidazole.
What is the SMILES notation for 1-[2-[2-(2,3-dimethyl-2H-imidazol-1-yl)ethoxy]ethyl]-2,3-dimethyl-2H-imidazole?
The canonical SMILES for 1-[2-[2-(2,3-dimethyl-2H-imidazol-1-yl)ethoxy]ethyl]-2,3-dimethyl-2H-imidazole is CC1N(C)C=CN1CCOCCN1C=CN(C)C1C.
What is the InChIKey of 1-[2-[2-(2,3-dimethyl-2H-imidazol-1-yl)ethoxy]ethyl]-2,3-dimethyl-2H-imidazole?
The InChIKey is MVAQNQVCCABEIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N4O/c1-13-15(3)5-7-17(13)9-11-19-12-10-18-8-6-16(4)14(18)2/h5-8,13-14H,9-12H2,1-4H3.
What are the key properties of 1-[2-[2-(2,3-dimethyl-2H-imidazol-1-yl)ethoxy]ethyl]-2,3-dimethyl-2H-imidazole?
1-[2-[2-(2,3-dimethyl-2H-imidazol-1-yl)ethoxy]ethyl]-2,3-dimethyl-2H-imidazole has a molecular weight of 266.39 g/mol, XLogP of 1.13, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[2-(2,3-dimethyl-2H-imidazol-1-yl)ethoxy]ethyl]-2,3-dimethyl-2H-imidazole is sourced from PubChem (CID 71268064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).