C12H16ClN3 — CID 71268113
(4aS)-10-chloro-1,2,3,4,4a,5,6,7-octahydropyrazino[1,2-a][1,5]benzodiazepine (PubChem CID 71268113) has the molecular formula C12H16ClN3 and a molecular weight of 237.73 g/mol. Its IUPAC name is (4aS)-10-chloro-1,2,3,4,4a,5,6,7-octahydropyrazino[1,2-a][1,5]benzodiazepine.
| Compound Name | (4aS)-10-chloro-1,2,3,4,4a,5,6,7-octahydropyrazino[1,2-a][1,5]benzodiazepine |
|---|---|
| PubChem CID | 71268113 |
| Molecular Formula | C12H16ClN3 |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | (4aS)-10-chloro-1,2,3,4,4a,5,6,7-octahydropyrazino[1,2-a][1,5]benzodiazepine |
| SMILES | Clc1ccc2c(c1)N1CCNC[C@@H]1CCN2 |
| InChI | InChI=1S/C12H16ClN3/c13-9-1-2-11-12(7-9)16-6-5-14-8-10(16)3-4-15-11/h1-2,7,10,14-15H,3-6,8H2/t10-/m0/s1 |
| InChIKey | ZYWCCZFKSYKSJN-JTQLQIEISA-N |
| XLogP | 1.93 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |