C21H32N2O5 — CID 71268124
ditert-butyl (3S,6R,8aS)-5-oxospiro[1,2,3,8a-tetrahydroindolizine-6,2'-pyrrolidine]-1',3-dicarboxylate (PubChem CID 71268124) has the molecular formula C21H32N2O5 and a molecular weight of 392.50 g/mol. Its IUPAC name is ditert-butyl (3S,6R,8aS)-5-oxospiro[1,2,3,8a-tetrahydroindolizine-6,2'-pyrrolidine]-1',3-dicarboxylate.
| Compound Name | ditert-butyl (3S,6R,8aS)-5-oxospiro[1,2,3,8a-tetrahydroindolizine-6,2'-pyrrolidine]-1',3-dicarboxylate |
|---|---|
| PubChem CID | 71268124 |
| Molecular Formula | C21H32N2O5 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | ditert-butyl (3S,6R,8aS)-5-oxospiro[1,2,3,8a-tetrahydroindolizine-6,2'-pyrrolidine]-1',3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CC[C@H]2C=C[C@]3(CCCN3C(=O)OC(C)(C)C)C(=O)N21 |
| InChI | InChI=1S/C21H32N2O5/c1-19(2,3)27-16(24)15-9-8-14-10-12-21(17(25)23(14)15)11-7-13-22(21)18(26)28-20(4,5)6/h10,12,14-15H,7-9,11,13H2,1-6H3/t14-,15-,21+/m0/s1 |
| InChIKey | YGOSBCIKELIWQL-VFCRVFHLSA-N |
| XLogP | 3.03 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|