C13H26N6O — CID 71268271
1-[[4-amino-6-(butylamino)-1,3,5-triazin-2-yl]-butylamino]ethanol (PubChem CID 71268271) has the molecular formula C13H26N6O and a molecular weight of 282.39 g/mol. Its IUPAC name is 1-[[4-amino-6-(butylamino)-1,3,5-triazin-2-yl]-butylamino]ethanol.
| Compound Name | 1-[[4-amino-6-(butylamino)-1,3,5-triazin-2-yl]-butylamino]ethanol |
|---|---|
| PubChem CID | 71268271 |
| Molecular Formula | C13H26N6O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | 1-[[4-amino-6-(butylamino)-1,3,5-triazin-2-yl]-butylamino]ethanol |
| SMILES | CCCCNc1nc(N)nc(N(CCCC)C(C)O)n1 |
| InChI | InChI=1S/C13H26N6O/c1-4-6-8-15-12-16-11(14)17-13(18-12)19(10(3)20)9-7-5-2/h10,20H,4-9H2,1-3H3,(H3,14,15,16,17,18) |
| InChIKey | NBHPPSQGSKZTQE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|