About [4-[2-[4-(2,6-dichloro-4-fluorophenoxy)piperidin-1-yl]ethyl]cyclohexyl]carbamic acid
[4-[2-[4-(2,6-dichloro-4-fluorophenoxy)piperidin-1-yl]ethyl]cyclohexyl]carbamic acid (PubChem CID 71268437) has the molecular formula C20H27Cl2FN2O3
and a molecular weight of 433.35 g/mol. Its IUPAC name is [4-[2-[4-(2,6-dichloro-4-fluorophenoxy)piperidin-1-yl]ethyl]cyclohexyl]carbamic acid.
Molecular Properties
| Compound Name | [4-[2-[4-(2,6-dichloro-4-fluorophenoxy)piperidin-1-yl]ethyl]cyclohexyl]carbamic acid |
| PubChem CID | 71268437 |
| Molecular Formula | C20H27Cl2FN2O3 |
| Molecular Weight | 433.35 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | [4-[2-[4-(2,6-dichloro-4-fluorophenoxy)piperidin-1-yl]ethyl]cyclohexyl]carbamic acid |
| SMILES | O=C(O)NC1CCC(CCN2CCC(Oc3c(Cl)cc(F)cc3Cl)CC2)CC1 |
| InChI | InChI=1S/C20H27Cl2FN2O3/c21-17-11-14(23)12-18(22)19(17)28-16-6-9-25(10-7-16)8-5-13-1-3-15(4-2-13)24-20(26)27/h11-13,15-16,24H,1-10H2,(H,26,27) |
| InChIKey | YUSHRGNLCYVSCJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.35 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-[2-[4-(2,6-dichloro-4-fluorophenoxy)piperidin-1-yl]ethyl]cyclohexyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-[4-(2,6-dichloro-4-fluorophenoxy)piperidin-1-yl]ethyl]cyclohexyl]carbamic acid?
The IUPAC name of [4-[2-[4-(2,6-dichloro-4-fluorophenoxy)piperidin-1-yl]ethyl]cyclohexyl]carbamic acid (CID 71268437) is [4-[2-[4-(2,6-dichloro-4-fluorophenoxy)piperidin-1-yl]ethyl]cyclohexyl]carbamic acid.
What is the SMILES notation for [4-[2-[4-(2,6-dichloro-4-fluorophenoxy)piperidin-1-yl]ethyl]cyclohexyl]carbamic acid?
The canonical SMILES for [4-[2-[4-(2,6-dichloro-4-fluorophenoxy)piperidin-1-yl]ethyl]cyclohexyl]carbamic acid is O=C(O)NC1CCC(CCN2CCC(Oc3c(Cl)cc(F)cc3Cl)CC2)CC1.
What is the InChIKey of [4-[2-[4-(2,6-dichloro-4-fluorophenoxy)piperidin-1-yl]ethyl]cyclohexyl]carbamic acid?
The InChIKey is YUSHRGNLCYVSCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27Cl2FN2O3/c21-17-11-14(23)12-18(22)19(17)28-16-6-9-25(10-7-16)8-5-13-1-3-15(4-2-13)24-20(26)27/h11-13,15-16,24H,1-10H2,(H,26,27).
What are the key properties of [4-[2-[4-(2,6-dichloro-4-fluorophenoxy)piperidin-1-yl]ethyl]cyclohexyl]carbamic acid?
[4-[2-[4-(2,6-dichloro-4-fluorophenoxy)piperidin-1-yl]ethyl]cyclohexyl]carbamic acid has a molecular weight of 433.35 g/mol, XLogP of 5.19, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-[4-(2,6-dichloro-4-fluorophenoxy)piperidin-1-yl]ethyl]cyclohexyl]carbamic acid is sourced from PubChem (CID 71268437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).