C14H21NO — CID 71268512
6-(3-piperidin-1-ylpropyl)cyclohexa-2,4-dien-1-one (PubChem CID 71268512) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 6-(3-piperidin-1-ylpropyl)cyclohexa-2,4-dien-1-one.
| Compound Name | 6-(3-piperidin-1-ylpropyl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 71268512 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 6-(3-piperidin-1-ylpropyl)cyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC=CC1CCCN1CCCCC1 |
| InChI | InChI=1S/C14H21NO/c16-14-9-3-2-7-13(14)8-6-12-15-10-4-1-5-11-15/h2-3,7,9,13H,1,4-6,8,10-12H2 |
| InChIKey | KQDOTIVCXAJGSA-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |