About [1-[4-[1-(1,3-dioxol-4-yl)-2-phenylethyl]piperazin-1-yl]-3-phenylpropyl]carbamic acid
[1-[4-[1-(1,3-dioxol-4-yl)-2-phenylethyl]piperazin-1-yl]-3-phenylpropyl]carbamic acid (PubChem CID 71268525) has the molecular formula C25H31N3O4
and a molecular weight of 437.54 g/mol. Its IUPAC name is [1-[4-[1-(1,3-dioxol-4-yl)-2-phenylethyl]piperazin-1-yl]-3-phenylpropyl]carbamic acid.
Molecular Properties
| Compound Name | [1-[4-[1-(1,3-dioxol-4-yl)-2-phenylethyl]piperazin-1-yl]-3-phenylpropyl]carbamic acid |
| PubChem CID | 71268525 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | [1-[4-[1-(1,3-dioxol-4-yl)-2-phenylethyl]piperazin-1-yl]-3-phenylpropyl]carbamic acid |
| SMILES | O=C(O)NC(CCc1ccccc1)N1CCN(C(Cc2ccccc2)C2=COCO2)CC1 |
| InChI | InChI=1S/C25H31N3O4/c29-25(30)26-24(12-11-20-7-3-1-4-8-20)28-15-13-27(14-16-28)22(23-18-31-19-32-23)17-21-9-5-2-6-10-21/h1-10,18,22,24,26H,11-17,19H2,(H,29,30) |
| InChIKey | LOGIYJOXKFRDRT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[4-[1-(1,3-dioxol-4-yl)-2-phenylethyl]piperazin-1-yl]-3-phenylpropyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-[1-(1,3-dioxol-4-yl)-2-phenylethyl]piperazin-1-yl]-3-phenylpropyl]carbamic acid?
The IUPAC name of [1-[4-[1-(1,3-dioxol-4-yl)-2-phenylethyl]piperazin-1-yl]-3-phenylpropyl]carbamic acid (CID 71268525) is [1-[4-[1-(1,3-dioxol-4-yl)-2-phenylethyl]piperazin-1-yl]-3-phenylpropyl]carbamic acid.
What is the SMILES notation for [1-[4-[1-(1,3-dioxol-4-yl)-2-phenylethyl]piperazin-1-yl]-3-phenylpropyl]carbamic acid?
The canonical SMILES for [1-[4-[1-(1,3-dioxol-4-yl)-2-phenylethyl]piperazin-1-yl]-3-phenylpropyl]carbamic acid is O=C(O)NC(CCc1ccccc1)N1CCN(C(Cc2ccccc2)C2=COCO2)CC1.
What is the InChIKey of [1-[4-[1-(1,3-dioxol-4-yl)-2-phenylethyl]piperazin-1-yl]-3-phenylpropyl]carbamic acid?
The InChIKey is LOGIYJOXKFRDRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H31N3O4/c29-25(30)26-24(12-11-20-7-3-1-4-8-20)28-15-13-27(14-16-28)22(23-18-31-19-32-23)17-21-9-5-2-6-10-21/h1-10,18,22,24,26H,11-17,19H2,(H,29,30).
What are the key properties of [1-[4-[1-(1,3-dioxol-4-yl)-2-phenylethyl]piperazin-1-yl]-3-phenylpropyl]carbamic acid?
[1-[4-[1-(1,3-dioxol-4-yl)-2-phenylethyl]piperazin-1-yl]-3-phenylpropyl]carbamic acid has a molecular weight of 437.54 g/mol, XLogP of 3.29, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-[1-(1,3-dioxol-4-yl)-2-phenylethyl]piperazin-1-yl]-3-phenylpropyl]carbamic acid is sourced from PubChem (CID 71268525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).