About N-[2,4-difluoro-3-(3-phenylquinoxaline-6-carbonyl)phenyl]propane-1-sulfonamide
N-[2,4-difluoro-3-(3-phenylquinoxaline-6-carbonyl)phenyl]propane-1-sulfonamide (PubChem CID 71268641) has the molecular formula C24H19F2N3O3S
and a molecular weight of 467.50 g/mol. Its IUPAC name is N-[2,4-difluoro-3-(3-phenylquinoxaline-6-carbonyl)phenyl]propane-1-sulfonamide.
Molecular Properties
| Compound Name | N-[2,4-difluoro-3-(3-phenylquinoxaline-6-carbonyl)phenyl]propane-1-sulfonamide |
| PubChem CID | 71268641 |
| Molecular Formula | C24H19F2N3O3S |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | N-[2,4-difluoro-3-(3-phenylquinoxaline-6-carbonyl)phenyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1ccc(F)c(C(=O)c2ccc3ncc(-c4ccccc4)nc3c2)c1F |
| InChI | InChI=1S/C24H19F2N3O3S/c1-2-12-33(31,32)29-19-11-9-17(25)22(23(19)26)24(30)16-8-10-18-20(13-16)28-21(14-27-18)15-6-4-3-5-7-15/h3-11,13-14,29H,2,12H2,1H3 |
| InChIKey | GIKVVFBPFKIJJI-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2,4-difluoro-3-(3-phenylquinoxaline-6-carbonyl)phenyl]propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,4-difluoro-3-(3-phenylquinoxaline-6-carbonyl)phenyl]propane-1-sulfonamide?
The IUPAC name of N-[2,4-difluoro-3-(3-phenylquinoxaline-6-carbonyl)phenyl]propane-1-sulfonamide (CID 71268641) is N-[2,4-difluoro-3-(3-phenylquinoxaline-6-carbonyl)phenyl]propane-1-sulfonamide.
What is the SMILES notation for N-[2,4-difluoro-3-(3-phenylquinoxaline-6-carbonyl)phenyl]propane-1-sulfonamide?
The canonical SMILES for N-[2,4-difluoro-3-(3-phenylquinoxaline-6-carbonyl)phenyl]propane-1-sulfonamide is CCCS(=O)(=O)Nc1ccc(F)c(C(=O)c2ccc3ncc(-c4ccccc4)nc3c2)c1F.
What is the InChIKey of N-[2,4-difluoro-3-(3-phenylquinoxaline-6-carbonyl)phenyl]propane-1-sulfonamide?
The InChIKey is GIKVVFBPFKIJJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19F2N3O3S/c1-2-12-33(31,32)29-19-11-9-17(25)22(23(19)26)24(30)16-8-10-18-20(13-16)28-21(14-27-18)15-6-4-3-5-7-15/h3-11,13-14,29H,2,12H2,1H3.
What are the key properties of N-[2,4-difluoro-3-(3-phenylquinoxaline-6-carbonyl)phenyl]propane-1-sulfonamide?
N-[2,4-difluoro-3-(3-phenylquinoxaline-6-carbonyl)phenyl]propane-1-sulfonamide has a molecular weight of 467.50 g/mol, XLogP of 4.96, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,4-difluoro-3-(3-phenylquinoxaline-6-carbonyl)phenyl]propane-1-sulfonamide is sourced from PubChem (CID 71268641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).