C14H18N2O2S — CID 71268733
(4aR,8aS)-8a-(2-methoxyphenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine (PubChem CID 71268733) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is (4aR,8aS)-8a-(2-methoxyphenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (4aR,8aS)-8a-(2-methoxyphenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 71268733 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (4aR,8aS)-8a-(2-methoxyphenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
| SMILES | COc1ccccc1[C@]12COCC[C@H]1CSC(N)=N2 |
| InChI | InChI=1S/C14H18N2O2S/c1-17-12-5-3-2-4-11(12)14-9-18-7-6-10(14)8-19-13(15)16-14/h2-5,10H,6-9H2,1H3,(H2,15,16)/t10-,14-/m0/s1 |
| InChIKey | KPKGHQOJLMRIRM-HZMBPMFUSA-N |
| XLogP | 1.99 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |