C14H16F2N2OS — CID 71268737
(4aR,6R,8aS)-6-(fluoromethyl)-8a-(2-fluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine (PubChem CID 71268737) has the molecular formula C14H16F2N2OS and a molecular weight of 298.36 g/mol. Its IUPAC name is (4aR,6R,8aS)-6-(fluoromethyl)-8a-(2-fluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (4aR,6R,8aS)-6-(fluoromethyl)-8a-(2-fluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 71268737 |
| Molecular Formula | C14H16F2N2OS |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | (4aR,6R,8aS)-6-(fluoromethyl)-8a-(2-fluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
| SMILES | NC1=N[C@@]2(c3ccccc3F)CO[C@@H](CF)C[C@H]2CS1 |
| InChI | InChI=1S/C14H16F2N2OS/c15-6-10-5-9-7-20-13(17)18-14(9,8-19-10)11-3-1-2-4-12(11)16/h1-4,9-10H,5-8H2,(H2,17,18)/t9-,10+,14-/m0/s1 |
| InChIKey | NWEXGZFJCUONNX-RBZYPMLTSA-N |
| XLogP | 2.46 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |