C16H21FN2O2S — CID 71268762
(4aR,6R,8aS)-6-(ethoxymethyl)-8a-(2-fluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine (PubChem CID 71268762) has the molecular formula C16H21FN2O2S and a molecular weight of 324.42 g/mol. Its IUPAC name is (4aR,6R,8aS)-6-(ethoxymethyl)-8a-(2-fluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (4aR,6R,8aS)-6-(ethoxymethyl)-8a-(2-fluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 71268762 |
| Molecular Formula | C16H21FN2O2S |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | (4aR,6R,8aS)-6-(ethoxymethyl)-8a-(2-fluorophenyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
| SMILES | CCOC[C@H]1C[C@H]2CSC(N)=N[C@@]2(c2ccccc2F)CO1 |
| InChI | InChI=1S/C16H21FN2O2S/c1-2-20-8-12-7-11-9-22-15(18)19-16(11,10-21-12)13-5-3-4-6-14(13)17/h3-6,11-12H,2,7-10H2,1H3,(H2,18,19)/t11-,12+,16-/m0/s1 |
| InChIKey | XJAAJTNTRUKWLE-OZVIIMIRSA-N |
| XLogP | 2.52 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |