C21H26N6O4 — CID 71269326
2-(azepan-1-yl)-4-(3,4,5-trimethoxyanilino)-6H-pyrimido[4,5-d]pyridazin-5-one (PubChem CID 71269326) has the molecular formula C21H26N6O4 and a molecular weight of 426.48 g/mol. Its IUPAC name is 2-(azepan-1-yl)-4-(3,4,5-trimethoxyanilino)-6H-pyrimido[4,5-d]pyridazin-5-one.
| Compound Name | 2-(azepan-1-yl)-4-(3,4,5-trimethoxyanilino)-6H-pyrimido[4,5-d]pyridazin-5-one |
|---|---|
| PubChem CID | 71269326 |
| Molecular Formula | C21H26N6O4 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 2-(azepan-1-yl)-4-(3,4,5-trimethoxyanilino)-6H-pyrimido[4,5-d]pyridazin-5-one |
| SMILES | COc1cc(Nc2nc(N3CCCCCC3)nc3cn[nH]c(=O)c23)cc(OC)c1OC |
| InChI | InChI=1S/C21H26N6O4/c1-29-15-10-13(11-16(30-2)18(15)31-3)23-19-17-14(12-22-26-20(17)28)24-21(25-19)27-8-6-4-5-7-9-27/h10-12H,4-9H2,1-3H3,(H,26,28)(H,23,24,25) |
| InChIKey | IXGXLAOQJCLGBO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 114.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |