C23H20F3N4O4S- — CID 71269612
5-(4-cyanophenoxy)-1-ethyl-3-[3-[3-[sulfinato(2,2,2-trifluoroethyl)amino]oxetan-3-yl]phenyl]pyrazole (PubChem CID 71269612) has the molecular formula C23H20F3N4O4S- and a molecular weight of 505.50 g/mol. Its IUPAC name is 5-(4-cyanophenoxy)-1-ethyl-3-[3-[3-[sulfinato(2,2,2-trifluoroethyl)amino]oxetan-3-yl]phenyl]pyrazole.
| Compound Name | 5-(4-cyanophenoxy)-1-ethyl-3-[3-[3-[sulfinato(2,2,2-trifluoroethyl)amino]oxetan-3-yl]phenyl]pyrazole |
|---|---|
| PubChem CID | 71269612 |
| Molecular Formula | C23H20F3N4O4S- |
| Molecular Weight | 505.50 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | 5-(4-cyanophenoxy)-1-ethyl-3-[3-[3-[sulfinato(2,2,2-trifluoroethyl)amino]oxetan-3-yl]phenyl]pyrazole |
| SMILES | CCn1nc(-c2cccc(C3(N(CC(F)(F)F)S(=O)[O-])COC3)c2)cc1Oc1ccc(C#N)cc1 |
| InChI | InChI=1S/C23H21F3N4O4S/c1-2-29-21(34-19-8-6-16(12-27)7-9-19)11-20(28-29)17-4-3-5-18(10-17)22(14-33-15-22)30(35(31)32)13-23(24,25)26/h3-11H,2,13-15H2,1H3,(H,31,32)/p-1 |
| InChIKey | SKOJWYLCXSJCJN-UHFFFAOYSA-M |
| XLogP | 4.12 |
| TPSA | 103.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|