About 6-bromo-4'-methoxyspiro[1,3-dihydroindene-2,1'-cyclohexane]-1-amine
6-bromo-4'-methoxyspiro[1,3-dihydroindene-2,1'-cyclohexane]-1-amine (PubChem CID 71269733) has the molecular formula C15H20BrNO
and a molecular weight of 310.24 g/mol. Its IUPAC name is 6-bromo-4'-methoxyspiro[1,3-dihydroindene-2,1'-cyclohexane]-1-amine.
Molecular Properties
| Compound Name | 6-bromo-4'-methoxyspiro[1,3-dihydroindene-2,1'-cyclohexane]-1-amine |
| PubChem CID | 71269733 |
| Molecular Formula | C15H20BrNO |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 6-bromo-4'-methoxyspiro[1,3-dihydroindene-2,1'-cyclohexane]-1-amine |
| SMILES | COC1CCC2(CC1)Cc1ccc(Br)cc1C2N |
| InChI | InChI=1S/C15H20BrNO/c1-18-12-4-6-15(7-5-12)9-10-2-3-11(16)8-13(10)14(15)17/h2-3,8,12,14H,4-7,9,17H2,1H3 |
| InChIKey | ZUJFERYYLJBYAN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-4'-methoxyspiro[1,3-dihydroindene-2,1'-cyclohexane]-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4'-methoxyspiro[1,3-dihydroindene-2,1'-cyclohexane]-1-amine?
The IUPAC name of 6-bromo-4'-methoxyspiro[1,3-dihydroindene-2,1'-cyclohexane]-1-amine (CID 71269733) is 6-bromo-4'-methoxyspiro[1,3-dihydroindene-2,1'-cyclohexane]-1-amine.
What is the SMILES notation for 6-bromo-4'-methoxyspiro[1,3-dihydroindene-2,1'-cyclohexane]-1-amine?
The canonical SMILES for 6-bromo-4'-methoxyspiro[1,3-dihydroindene-2,1'-cyclohexane]-1-amine is COC1CCC2(CC1)Cc1ccc(Br)cc1C2N.
What is the InChIKey of 6-bromo-4'-methoxyspiro[1,3-dihydroindene-2,1'-cyclohexane]-1-amine?
The InChIKey is ZUJFERYYLJBYAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20BrNO/c1-18-12-4-6-15(7-5-12)9-10-2-3-11(16)8-13(10)14(15)17/h2-3,8,12,14H,4-7,9,17H2,1H3.
What are the key properties of 6-bromo-4'-methoxyspiro[1,3-dihydroindene-2,1'-cyclohexane]-1-amine?
6-bromo-4'-methoxyspiro[1,3-dihydroindene-2,1'-cyclohexane]-1-amine has a molecular weight of 310.24 g/mol, XLogP of 3.58, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4'-methoxyspiro[1,3-dihydroindene-2,1'-cyclohexane]-1-amine is sourced from PubChem (CID 71269733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).