C22H22FN7O — CID 71270555
12-[4-[(dimethylamino)methyl]phenyl]-7-fluoro-13-(1H-1,2,4-triazol-5-yl)-2,3,11-triazatricyclo[7.4.1.05,14]tetradeca-1,5,7,9(14)-tetraen-4-one (PubChem CID 71270555) has the molecular formula C22H22FN7O and a molecular weight of 419.46 g/mol. Its IUPAC name is 12-[4-[(dimethylamino)methyl]phenyl]-7-fluoro-13-(1H-1,2,4-triazol-5-yl)-2,3,11-triazatricyclo[7.4.1.05,14]tetradeca-1,5,7,9(14)-tetraen-4-one.
| Compound Name | 12-[4-[(dimethylamino)methyl]phenyl]-7-fluoro-13-(1H-1,2,4-triazol-5-yl)-2,3,11-triazatricyclo[7.4.1.05,14]tetradeca-1,5,7,9(14)-tetraen-4-one |
|---|---|
| PubChem CID | 71270555 |
| Molecular Formula | C22H22FN7O |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 12-[4-[(dimethylamino)methyl]phenyl]-7-fluoro-13-(1H-1,2,4-triazol-5-yl)-2,3,11-triazatricyclo[7.4.1.05,14]tetradeca-1,5,7,9(14)-tetraen-4-one |
| SMILES | CN(C)Cc1ccc(C2NCc3cc(F)cc4c(=O)[nH]nc(c34)C2c2ncn[nH]2)cc1 |
| InChI | InChI=1S/C22H22FN7O/c1-30(2)10-12-3-5-13(6-4-12)19-18(21-25-11-26-28-21)20-17-14(9-24-19)7-15(23)8-16(17)22(31)29-27-20/h3-8,11,18-19,24H,9-10H2,1-2H3,(H,29,31)(H,25,26,28) |
| InChIKey | KRCZHUJKSKXLPD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 102.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |