C17H12ClNO3 — CID 71270644
2-[(1R,2R)-5-chloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl]isoindole-1,3-dione (PubChem CID 71270644) has the molecular formula C17H12ClNO3 and a molecular weight of 313.74 g/mol. Its IUPAC name is 2-[(1R,2R)-5-chloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[(1R,2R)-5-chloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 71270644 |
| Molecular Formula | C17H12ClNO3 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 2-[(1R,2R)-5-chloro-2-hydroxy-2,3-dihydro-1H-inden-1-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1[C@@H]1c2ccc(Cl)cc2C[C@H]1O |
| InChI | InChI=1S/C17H12ClNO3/c18-10-5-6-11-9(7-10)8-14(20)15(11)19-16(21)12-3-1-2-4-13(12)17(19)22/h1-7,14-15,20H,8H2/t14-,15-/m1/s1 |
| InChIKey | DONITKQDVMKOGI-HUUCEWRRSA-N |
| XLogP | 2.59 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|