About 3-[(2,3-dichlorophenyl)methyl]-2-methoxy-5-pyridin-4-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one
3-[(2,3-dichlorophenyl)methyl]-2-methoxy-5-pyridin-4-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 71270723) has the molecular formula C19H14Cl2N4O2
and a molecular weight of 401.25 g/mol. Its IUPAC name is 3-[(2,3-dichlorophenyl)methyl]-2-methoxy-5-pyridin-4-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 3-[(2,3-dichlorophenyl)methyl]-2-methoxy-5-pyridin-4-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| PubChem CID | 71270723 |
| Molecular Formula | C19H14Cl2N4O2 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 3-[(2,3-dichlorophenyl)methyl]-2-methoxy-5-pyridin-4-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | COc1[nH]n2c(=O)cc(-c3ccncc3)nc2c1Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C19H14Cl2N4O2/c1-27-19-13(9-12-3-2-4-14(20)17(12)21)18-23-15(10-16(26)25(18)24-19)11-5-7-22-8-6-11/h2-8,10,24H,9H2,1H3 |
| InChIKey | ZQXAFUNJAAUTSB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(2,3-dichlorophenyl)methyl]-2-methoxy-5-pyridin-4-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,3-dichlorophenyl)methyl]-2-methoxy-5-pyridin-4-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The IUPAC name of 3-[(2,3-dichlorophenyl)methyl]-2-methoxy-5-pyridin-4-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one (CID 71270723) is 3-[(2,3-dichlorophenyl)methyl]-2-methoxy-5-pyridin-4-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
What is the SMILES notation for 3-[(2,3-dichlorophenyl)methyl]-2-methoxy-5-pyridin-4-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The canonical SMILES for 3-[(2,3-dichlorophenyl)methyl]-2-methoxy-5-pyridin-4-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one is COc1[nH]n2c(=O)cc(-c3ccncc3)nc2c1Cc1cccc(Cl)c1Cl.
What is the InChIKey of 3-[(2,3-dichlorophenyl)methyl]-2-methoxy-5-pyridin-4-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The InChIKey is ZQXAFUNJAAUTSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14Cl2N4O2/c1-27-19-13(9-12-3-2-4-14(20)17(12)21)18-23-15(10-16(26)25(18)24-19)11-5-7-22-8-6-11/h2-8,10,24H,9H2,1H3.
What are the key properties of 3-[(2,3-dichlorophenyl)methyl]-2-methoxy-5-pyridin-4-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
3-[(2,3-dichlorophenyl)methyl]-2-methoxy-5-pyridin-4-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one has a molecular weight of 401.25 g/mol, XLogP of 3.99, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,3-dichlorophenyl)methyl]-2-methoxy-5-pyridin-4-yl-1H-pyrazolo[1,5-a]pyrimidin-7-one is sourced from PubChem (CID 71270723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).