About morpholine;5-phenyl-1H-pyrazole
morpholine;5-phenyl-1H-pyrazole (PubChem CID 71270816) has the molecular formula C13H17N3O
and a molecular weight of 231.30 g/mol. Its IUPAC name is morpholine;5-phenyl-1H-pyrazole.
Molecular Properties
| Compound Name | morpholine;5-phenyl-1H-pyrazole |
| PubChem CID | 71270816 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | morpholine;5-phenyl-1H-pyrazole |
| SMILES | C1COCCN1.c1ccc(-c2ccn[nH]2)cc1 |
| InChI | InChI=1S/C9H8N2.C4H9NO/c1-2-4-8(5-3-1)9-6-7-10-11-9;1-3-6-4-2-5-1/h1-7H,(H,10,11);5H,1-4H2 |
| InChIKey | DVXHPLLYEFZEEZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze morpholine;5-phenyl-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholine;5-phenyl-1H-pyrazole?
The IUPAC name of morpholine;5-phenyl-1H-pyrazole (CID 71270816) is morpholine;5-phenyl-1H-pyrazole.
What is the SMILES notation for morpholine;5-phenyl-1H-pyrazole?
The canonical SMILES for morpholine;5-phenyl-1H-pyrazole is C1COCCN1.c1ccc(-c2ccn[nH]2)cc1.
What is the InChIKey of morpholine;5-phenyl-1H-pyrazole?
The InChIKey is DVXHPLLYEFZEEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.C4H9NO/c1-2-4-8(5-3-1)9-6-7-10-11-9;1-3-6-4-2-5-1/h1-7H,(H,10,11);5H,1-4H2.
What are the key properties of morpholine;5-phenyl-1H-pyrazole?
morpholine;5-phenyl-1H-pyrazole has a molecular weight of 231.30 g/mol, XLogP of 1.68, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine;5-phenyl-1H-pyrazole is sourced from PubChem (CID 71270816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).