C6H10FN3O4 — CID 71271391
(2R,3S,4S,5R)-6-azido-5-fluoro-2-(hydroxymethyl)oxane-3,4-diol (PubChem CID 71271391) has the molecular formula C6H10FN3O4 and a molecular weight of 207.16 g/mol. Its IUPAC name is (2R,3S,4S,5R)-6-azido-5-fluoro-2-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2R,3S,4S,5R)-6-azido-5-fluoro-2-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 71271391 |
| Molecular Formula | C6H10FN3O4 |
| Molecular Weight | 207.16 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | (2R,3S,4S,5R)-6-azido-5-fluoro-2-(hydroxymethyl)oxane-3,4-diol |
| SMILES | [N-]=[N+]=NC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1F |
| InChI | InChI=1S/C6H10FN3O4/c7-3-5(13)4(12)2(1-11)14-6(3)9-10-8/h2-6,11-13H,1H2/t2-,3-,4-,5-,6?/m1/s1 |
| InChIKey | USWPZYOMDAIBIH-IVMDWMLBSA-N |
| XLogP | -0.93 |
| TPSA | 118.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.16 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|