About 6,6-dimethyl-2-(6-methyl-2-pyridinyl)-4-phenyl-7,8-dihydro-5H-quinazoline
6,6-dimethyl-2-(6-methyl-2-pyridinyl)-4-phenyl-7,8-dihydro-5H-quinazoline (PubChem CID 71271580) has the molecular formula C22H23N3
and a molecular weight of 329.45 g/mol. Its IUPAC name is 6,6-dimethyl-2-(6-methyl-2-pyridinyl)-4-phenyl-7,8-dihydro-5H-quinazoline.
Molecular Properties
| Compound Name | 6,6-dimethyl-2-(6-methyl-2-pyridinyl)-4-phenyl-7,8-dihydro-5H-quinazoline |
| PubChem CID | 71271580 |
| Molecular Formula | C22H23N3 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 6,6-dimethyl-2-(6-methyl-2-pyridinyl)-4-phenyl-7,8-dihydro-5H-quinazoline |
| SMILES | Cc1cccc(-c2nc3c(c(-c4ccccc4)n2)CC(C)(C)CC3)n1 |
| InChI | InChI=1S/C22H23N3/c1-15-8-7-11-19(23-15)21-24-18-12-13-22(2,3)14-17(18)20(25-21)16-9-5-4-6-10-16/h4-11H,12-14H2,1-3H3 |
| InChIKey | IVUAIABDAZIIDF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,6-dimethyl-2-(6-methyl-2-pyridinyl)-4-phenyl-7,8-dihydro-5H-quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-2-(6-methyl-2-pyridinyl)-4-phenyl-7,8-dihydro-5H-quinazoline?
The IUPAC name of 6,6-dimethyl-2-(6-methyl-2-pyridinyl)-4-phenyl-7,8-dihydro-5H-quinazoline (CID 71271580) is 6,6-dimethyl-2-(6-methyl-2-pyridinyl)-4-phenyl-7,8-dihydro-5H-quinazoline.
What is the SMILES notation for 6,6-dimethyl-2-(6-methyl-2-pyridinyl)-4-phenyl-7,8-dihydro-5H-quinazoline?
The canonical SMILES for 6,6-dimethyl-2-(6-methyl-2-pyridinyl)-4-phenyl-7,8-dihydro-5H-quinazoline is Cc1cccc(-c2nc3c(c(-c4ccccc4)n2)CC(C)(C)CC3)n1.
What is the InChIKey of 6,6-dimethyl-2-(6-methyl-2-pyridinyl)-4-phenyl-7,8-dihydro-5H-quinazoline?
The InChIKey is IVUAIABDAZIIDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N3/c1-15-8-7-11-19(23-15)21-24-18-12-13-22(2,3)14-17(18)20(25-21)16-9-5-4-6-10-16/h4-11H,12-14H2,1-3H3.
What are the key properties of 6,6-dimethyl-2-(6-methyl-2-pyridinyl)-4-phenyl-7,8-dihydro-5H-quinazoline?
6,6-dimethyl-2-(6-methyl-2-pyridinyl)-4-phenyl-7,8-dihydro-5H-quinazoline has a molecular weight of 329.45 g/mol, XLogP of 5.03, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-2-(6-methyl-2-pyridinyl)-4-phenyl-7,8-dihydro-5H-quinazoline is sourced from PubChem (CID 71271580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).