C12H13NO3S — CID 71272202
6-(2,4-dioxothietan-3-yl)-5,6-dimethylcyclohexa-2,4-diene-1-carboxamide (PubChem CID 71272202) has the molecular formula C12H13NO3S and a molecular weight of 251.31 g/mol. Its IUPAC name is 6-(2,4-dioxothietan-3-yl)-5,6-dimethylcyclohexa-2,4-diene-1-carboxamide.
| Compound Name | 6-(2,4-dioxothietan-3-yl)-5,6-dimethylcyclohexa-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 71272202 |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 6-(2,4-dioxothietan-3-yl)-5,6-dimethylcyclohexa-2,4-diene-1-carboxamide |
| SMILES | CC1=CC=CC(C(N)=O)C1(C)C1C(=O)SC1=O |
| InChI | InChI=1S/C12H13NO3S/c1-6-4-3-5-7(9(13)14)12(6,2)8-10(15)17-11(8)16/h3-5,7-8H,1-2H3,(H2,13,14) |
| InChIKey | VKMRSRSIACZTRE-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|