About 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[4-(8-hydroxyoctoxy)phenyl]prop-2-enenitrile
3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[4-(8-hydroxyoctoxy)phenyl]prop-2-enenitrile (PubChem CID 71272409) has the molecular formula C25H29NO4
and a molecular weight of 407.51 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[4-(8-hydroxyoctoxy)phenyl]prop-2-enenitrile.
Molecular Properties
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[4-(8-hydroxyoctoxy)phenyl]prop-2-enenitrile |
| PubChem CID | 71272409 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[4-(8-hydroxyoctoxy)phenyl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc2c(c1)OCCO2)c1ccc(OCCCCCCCCO)cc1 |
| InChI | InChI=1S/C25H29NO4/c26-19-22(17-20-7-12-24-25(18-20)30-16-15-29-24)21-8-10-23(11-9-21)28-14-6-4-2-1-3-5-13-27/h7-12,17-18,27H,1-6,13-16H2 |
| InChIKey | UARDREPAQTYMOD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 71.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[4-(8-hydroxyoctoxy)phenyl]prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[4-(8-hydroxyoctoxy)phenyl]prop-2-enenitrile?
The IUPAC name of 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[4-(8-hydroxyoctoxy)phenyl]prop-2-enenitrile (CID 71272409) is 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[4-(8-hydroxyoctoxy)phenyl]prop-2-enenitrile.
What is the SMILES notation for 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[4-(8-hydroxyoctoxy)phenyl]prop-2-enenitrile?
The canonical SMILES for 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[4-(8-hydroxyoctoxy)phenyl]prop-2-enenitrile is N#CC(=Cc1ccc2c(c1)OCCO2)c1ccc(OCCCCCCCCO)cc1.
What is the InChIKey of 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[4-(8-hydroxyoctoxy)phenyl]prop-2-enenitrile?
The InChIKey is UARDREPAQTYMOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29NO4/c26-19-22(17-20-7-12-24-25(18-20)30-16-15-29-24)21-8-10-23(11-9-21)28-14-6-4-2-1-3-5-13-27/h7-12,17-18,27H,1-6,13-16H2.
What are the key properties of 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[4-(8-hydroxyoctoxy)phenyl]prop-2-enenitrile?
3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[4-(8-hydroxyoctoxy)phenyl]prop-2-enenitrile has a molecular weight of 407.51 g/mol, XLogP of 5.23, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-[4-(8-hydroxyoctoxy)phenyl]prop-2-enenitrile is sourced from PubChem (CID 71272409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).