C20H25ClN4O6S — CID 71272568
[(1S,2S,4R)-4-[6-[[(1R,2S)-5-chloro-2-methoxy-2,3-dihydro-1H-inden-1-yl]amino]pyrimidin-4-yl]oxy-2-hydroxycyclopentyl]methylsulfamic acid (PubChem CID 71272568) has the molecular formula C20H25ClN4O6S and a molecular weight of 484.96 g/mol. Its IUPAC name is [(1S,2S,4R)-4-[6-[[(1R,2S)-5-chloro-2-methoxy-2,3-dihydro-1H-inden-1-yl]amino]pyrimidin-4-yl]oxy-2-hydroxycyclopentyl]methylsulfamic acid.
| Compound Name | [(1S,2S,4R)-4-[6-[[(1R,2S)-5-chloro-2-methoxy-2,3-dihydro-1H-inden-1-yl]amino]pyrimidin-4-yl]oxy-2-hydroxycyclopentyl]methylsulfamic acid |
|---|---|
| PubChem CID | 71272568 |
| Molecular Formula | C20H25ClN4O6S |
| Molecular Weight | 484.96 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | [(1S,2S,4R)-4-[6-[[(1R,2S)-5-chloro-2-methoxy-2,3-dihydro-1H-inden-1-yl]amino]pyrimidin-4-yl]oxy-2-hydroxycyclopentyl]methylsulfamic acid |
| SMILES | CO[C@H]1Cc2cc(Cl)ccc2[C@H]1Nc1cc(O[C@@H]2C[C@@H](CNS(=O)(=O)O)[C@@H](O)C2)ncn1 |
| InChI | InChI=1S/C20H25ClN4O6S/c1-30-17-6-11-4-13(21)2-3-15(11)20(17)25-18-8-19(23-10-22-18)31-14-5-12(16(26)7-14)9-24-32(27,28)29/h2-4,8,10,12,14,16-17,20,24,26H,5-7,9H2,1H3,(H,22,23,25)(H,27,28,29)/t12-,14+,16-,17-,20+/m0/s1 |
| InChIKey | ZEZWDYQVGGVCOK-RCVGXTDISA-N |
| XLogP | 1.76 |
| TPSA | 142.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.96 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|