C12H8F2O4S2 — CID 71273597
3-fluoro-5-(3-fluoro-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 71273597) has the molecular formula C12H8F2O4S2 and a molecular weight of 318.32 g/mol. Its IUPAC name is 3-fluoro-5-(3-fluoro-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 3-fluoro-5-(3-fluoro-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 71273597 |
| Molecular Formula | C12H8F2O4S2 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 317.98 |
| IUPAC Name | 3-fluoro-5-(3-fluoro-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | FC1COc2c(csc2-c2scc3c2OC(F)CO3)O1 |
| InChI | InChI=1S/C12H8F2O4S2/c13-7-2-16-9-6(17-7)4-20-11(9)12-10-5(3-19-12)15-1-8(14)18-10/h3-4,7-8H,1-2H2 |
| InChIKey | MZDMLRWGARTFEB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |