C24H34O10S2 — CID 71273604
3-[2-(2-methoxyethoxy)ethoxymethyl]-5-[3-[2-(2-methoxyethoxy)ethoxymethyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 71273604) has the molecular formula C24H34O10S2 and a molecular weight of 546.66 g/mol. Its IUPAC name is 3-[2-(2-methoxyethoxy)ethoxymethyl]-5-[3-[2-(2-methoxyethoxy)ethoxymethyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 3-[2-(2-methoxyethoxy)ethoxymethyl]-5-[3-[2-(2-methoxyethoxy)ethoxymethyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 71273604 |
| Molecular Formula | C24H34O10S2 |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | 3-[2-(2-methoxyethoxy)ethoxymethyl]-5-[3-[2-(2-methoxyethoxy)ethoxymethyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | COCCOCCOCC1COc2c(csc2-c2scc3c2OC(COCCOCCOC)CO3)O1 |
| InChI | InChI=1S/C24H34O10S2/c1-25-3-5-27-7-9-29-11-17-14-32-21-20(33-17)16-36-23(21)24-22-19(15-35-24)31-13-18(34-22)12-30-10-8-28-6-4-26-2/h15-18H,3-14H2,1-2H3 |
| InChIKey | QRCCMAXYDMSXHU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|