About [(7aS)-5,7a-dimethyl-6,7-dihydroinden-1-yl]oxy-trimethylsilane
[(7aS)-5,7a-dimethyl-6,7-dihydroinden-1-yl]oxy-trimethylsilane (PubChem CID 71274034) has the molecular formula C14H22OSi
and a molecular weight of 234.41 g/mol. Its IUPAC name is [(7aS)-5,7a-dimethyl-6,7-dihydroinden-1-yl]oxy-trimethylsilane.
Molecular Properties
| Compound Name | [(7aS)-5,7a-dimethyl-6,7-dihydroinden-1-yl]oxy-trimethylsilane |
| PubChem CID | 71274034 |
| Molecular Formula | C14H22OSi |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | [(7aS)-5,7a-dimethyl-6,7-dihydroinden-1-yl]oxy-trimethylsilane |
| SMILES | CC1=CC2=CC=C(O[Si](C)(C)C)[C@@]2(C)CC1 |
| InChI | InChI=1S/C14H22OSi/c1-11-8-9-14(2)12(10-11)6-7-13(14)15-16(3,4)5/h6-7,10H,8-9H2,1-5H3/t14-/m0/s1 |
| InChIKey | MWZAHLFOJGLMHN-AWEZNQCLSA-N |
| XLogP | 4.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(7aS)-5,7a-dimethyl-6,7-dihydroinden-1-yl]oxy-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(7aS)-5,7a-dimethyl-6,7-dihydroinden-1-yl]oxy-trimethylsilane?
The IUPAC name of [(7aS)-5,7a-dimethyl-6,7-dihydroinden-1-yl]oxy-trimethylsilane (CID 71274034) is [(7aS)-5,7a-dimethyl-6,7-dihydroinden-1-yl]oxy-trimethylsilane.
What is the SMILES notation for [(7aS)-5,7a-dimethyl-6,7-dihydroinden-1-yl]oxy-trimethylsilane?
The canonical SMILES for [(7aS)-5,7a-dimethyl-6,7-dihydroinden-1-yl]oxy-trimethylsilane is CC1=CC2=CC=C(O[Si](C)(C)C)[C@@]2(C)CC1.
What is the InChIKey of [(7aS)-5,7a-dimethyl-6,7-dihydroinden-1-yl]oxy-trimethylsilane?
The InChIKey is MWZAHLFOJGLMHN-AWEZNQCLSA-N. The full InChI is InChI=1S/C14H22OSi/c1-11-8-9-14(2)12(10-11)6-7-13(14)15-16(3,4)5/h6-7,10H,8-9H2,1-5H3/t14-/m0/s1.
What are the key properties of [(7aS)-5,7a-dimethyl-6,7-dihydroinden-1-yl]oxy-trimethylsilane?
[(7aS)-5,7a-dimethyl-6,7-dihydroinden-1-yl]oxy-trimethylsilane has a molecular weight of 234.41 g/mol, XLogP of 4.41, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(7aS)-5,7a-dimethyl-6,7-dihydroinden-1-yl]oxy-trimethylsilane is sourced from PubChem (CID 71274034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).