C59H46N4 — CID 71274470
9-[4-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,6,6,10,12,12-hexamethylindeno[1,2-b]fluoren-8-yl]phenyl]carbazole (PubChem CID 71274470) has the molecular formula C59H46N4 and a molecular weight of 811.05 g/mol. Its IUPAC name is 9-[4-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,6,6,10,12,12-hexamethylindeno[1,2-b]fluoren-8-yl]phenyl]carbazole.
| Compound Name | 9-[4-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,6,6,10,12,12-hexamethylindeno[1,2-b]fluoren-8-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 71274470 |
| Molecular Formula | C59H46N4 |
| Molecular Weight | 811.05 g/mol |
| Exact Mass | 810.37 |
| IUPAC Name | 9-[4-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-4,6,6,10,12,12-hexamethylindeno[1,2-b]fluoren-8-yl]phenyl]carbazole |
| SMILES | Cc1cc(-c2ccc(-n3c4ccccc4c4ccccc43)cc2)cc2c1-c1cc3c(cc1C2(C)C)-c1c(C)cc(-c2nc(-c4ccccc4)nc(-c4ccccc4)n2)cc1C3(C)C |
| InChI | InChI=1S/C59H46N4/c1-35-29-40(37-25-27-42(28-26-37)63-51-23-15-13-21-43(51)44-22-14-16-24-52(44)63)31-49-53(35)45-33-48-46(34-47(45)58(49,3)4)54-36(2)30-41(32-50(54)59(48,5)6)57-61-55(38-17-9-7-10-18-38)60-56(62-57)39-19-11-8-12-20-39/h7-34H,1-6H3 |
| InChIKey | AOTHXPRTYXHZPS-UHFFFAOYSA-N |
| XLogP | 14.87 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.05 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |