C28H30F2O14 — CID 71274659
bis[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethyl] 2-(2,2-difluoropropanoyloxy)pentanedioate (PubChem CID 71274659) has the molecular formula C28H30F2O14 and a molecular weight of 628.53 g/mol. Its IUPAC name is bis[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethyl] 2-(2,2-difluoropropanoyloxy)pentanedioate.
| Compound Name | bis[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethyl] 2-(2,2-difluoropropanoyloxy)pentanedioate |
|---|---|
| PubChem CID | 71274659 |
| Molecular Formula | C28H30F2O14 |
| Molecular Weight | 628.53 g/mol |
| Exact Mass | 628.16 |
| IUPAC Name | bis[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethyl] 2-(2,2-difluoropropanoyloxy)pentanedioate |
| SMILES | CC(F)(F)C(=O)OC(CCC(=O)OCC(=O)OC1C2CC3C(=O)OC1C3C2)C(=O)OCC(=O)OC1C2CC3C(=O)OC1C3C2 |
| InChI | InChI=1S/C28H30F2O14/c1-28(29,30)27(37)40-16(26(36)39-9-19(33)42-21-11-5-13-15(7-11)25(35)44-23(13)21)2-3-17(31)38-8-18(32)41-20-10-4-12-14(6-10)24(34)43-22(12)20/h10-16,20-23H,2-9H2,1H3 |
| InChIKey | LSGRVMAZDJFFEC-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 184.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.53 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|