C29H34F3NO2 — CID 71275261
(3R,9S)-4-cyclopentyl-7,7-dimethyl-3-[3-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol (PubChem CID 71275261) has the molecular formula C29H34F3NO2 and a molecular weight of 485.59 g/mol. Its IUPAC name is (3R,9S)-4-cyclopentyl-7,7-dimethyl-3-[3-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol.
| Compound Name | (3R,9S)-4-cyclopentyl-7,7-dimethyl-3-[3-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol |
|---|---|
| PubChem CID | 71275261 |
| Molecular Formula | C29H34F3NO2 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | (3R,9S)-4-cyclopentyl-7,7-dimethyl-3-[3-(trifluoromethyl)phenyl]spiro[3,6,8,9-tetrahydrofuro[3,4-c]quinoline-1,1'-cyclopentane]-9-ol |
| SMILES | CC1(C)Cc2nc(C3CCCC3)c3c(c2[C@@H](O)C1)C1(CCCC1)O[C@@H]3c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H34F3NO2/c1-27(2)15-20-22(21(34)16-27)24-23(25(33-20)17-8-3-4-9-17)26(35-28(24)12-5-6-13-28)18-10-7-11-19(14-18)29(30,31)32/h7,10-11,14,17,21,26,34H,3-6,8-9,12-13,15-16H2,1-2H3/t21-,26+/m0/s1 |
| InChIKey | YCMBMUMCSVIXBP-HFZDXXHNSA-N |
| XLogP | 7.65 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |