C22H21ClF4N2O2 — CID 71275542
1-[6-chloro-2-(trifluoromethyl)-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl]-2-(3-fluoro-4-methoxyphenyl)propan-2-ol (PubChem CID 71275542) has the molecular formula C22H21ClF4N2O2 and a molecular weight of 456.87 g/mol. Its IUPAC name is 1-[6-chloro-2-(trifluoromethyl)-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl]-2-(3-fluoro-4-methoxyphenyl)propan-2-ol.
| Compound Name | 1-[6-chloro-2-(trifluoromethyl)-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl]-2-(3-fluoro-4-methoxyphenyl)propan-2-ol |
|---|---|
| PubChem CID | 71275542 |
| Molecular Formula | C22H21ClF4N2O2 |
| Molecular Weight | 456.87 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 1-[6-chloro-2-(trifluoromethyl)-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl]-2-(3-fluoro-4-methoxyphenyl)propan-2-ol |
| SMILES | COc1ccc(C(C)(O)Cn2c3c(c4cc(Cl)ccc42)CCN(C(F)(F)F)C3)cc1F |
| InChI | InChI=1S/C22H21ClF4N2O2/c1-21(30,13-3-6-20(31-2)17(24)9-13)12-29-18-5-4-14(23)10-16(18)15-7-8-28(11-19(15)29)22(25,26)27/h3-6,9-10,30H,7-8,11-12H2,1-2H3 |
| InChIKey | INMJEVKGERLWSV-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 37.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.87 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|