C19H25FN4O8 — CID 71275699
(2S)-2-[[[(1S)-1-carboxy-5-[(6-fluoropyridine-3-carbonyl)amino]pentyl]-methylcarbamoyl]amino]pentanedioic acid (PubChem CID 71275699) has the molecular formula C19H25FN4O8 and a molecular weight of 456.43 g/mol. Its IUPAC name is (2S)-2-[[[(1S)-1-carboxy-5-[(6-fluoropyridine-3-carbonyl)amino]pentyl]-methylcarbamoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[[(1S)-1-carboxy-5-[(6-fluoropyridine-3-carbonyl)amino]pentyl]-methylcarbamoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 71275699 |
| Molecular Formula | C19H25FN4O8 |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | (2S)-2-[[[(1S)-1-carboxy-5-[(6-fluoropyridine-3-carbonyl)amino]pentyl]-methylcarbamoyl]amino]pentanedioic acid |
| SMILES | CN(C(=O)N[C@@H](CCC(=O)O)C(=O)O)[C@@H](CCCCNC(=O)c1ccc(F)nc1)C(=O)O |
| InChI | InChI=1S/C19H25FN4O8/c1-24(19(32)23-12(17(28)29)6-8-15(25)26)13(18(30)31)4-2-3-9-21-16(27)11-5-7-14(20)22-10-11/h5,7,10,12-13H,2-4,6,8-9H2,1H3,(H,21,27)(H,23,32)(H,25,26)(H,28,29)(H,30,31)/t12-,13-/m0/s1 |
| InChIKey | RZIPNFHZLABCBC-STQMWFEESA-N |
| XLogP | 0.53 |
| TPSA | 186.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|