C19H25N5O4S — CID 71275812
(3aR,5R,6S,7R,7aR)-2-(ethylamino)-5-[[4-(1-hydroxy-1-phenylethyl)triazol-1-yl]methyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol (PubChem CID 71275812) has the molecular formula C19H25N5O4S and a molecular weight of 419.51 g/mol. Its IUPAC name is (3aR,5R,6S,7R,7aR)-2-(ethylamino)-5-[[4-(1-hydroxy-1-phenylethyl)triazol-1-yl]methyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol.
| Compound Name | (3aR,5R,6S,7R,7aR)-2-(ethylamino)-5-[[4-(1-hydroxy-1-phenylethyl)triazol-1-yl]methyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 71275812 |
| Molecular Formula | C19H25N5O4S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | (3aR,5R,6S,7R,7aR)-2-(ethylamino)-5-[[4-(1-hydroxy-1-phenylethyl)triazol-1-yl]methyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
| SMILES | CCNC1=N[C@@H]2[C@@H](O)[C@H](O)[C@@H](Cn3cc(C(C)(O)c4ccccc4)nn3)O[C@@H]2S1 |
| InChI | InChI=1S/C19H25N5O4S/c1-3-20-18-21-14-16(26)15(25)12(28-17(14)29-18)9-24-10-13(22-23-24)19(2,27)11-7-5-4-6-8-11/h4-8,10,12,14-17,25-27H,3,9H2,1-2H3,(H,20,21)/t12-,14-,15-,16-,17-,19?/m1/s1 |
| InChIKey | QMVVWAZGPYFKRA-RUJKWDNJSA-N |
| XLogP | 0.06 |
| TPSA | 125.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |