C30H37F3N8O4 — CID 71276150
tert-butyl N-[(3R,4S)-1-[5-[[1-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]-methylcarbamoyl]pyrimidin-2-yl]-4-(2,4,5-trifluorophenyl)pyrrolidin-3-yl]carbamate (PubChem CID 71276150) has the molecular formula C30H37F3N8O4 and a molecular weight of 630.67 g/mol. Its IUPAC name is tert-butyl N-[(3R,4S)-1-[5-[[1-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]-methylcarbamoyl]pyrimidin-2-yl]-4-(2,4,5-trifluorophenyl)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4S)-1-[5-[[1-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]-methylcarbamoyl]pyrimidin-2-yl]-4-(2,4,5-trifluorophenyl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 71276150 |
| Molecular Formula | C30H37F3N8O4 |
| Molecular Weight | 630.67 g/mol |
| Exact Mass | 630.29 |
| IUPAC Name | tert-butyl N-[(3R,4S)-1-[5-[[1-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]-methylcarbamoyl]pyrimidin-2-yl]-4-(2,4,5-trifluorophenyl)pyrrolidin-3-yl]carbamate |
| SMILES | CCc1noc(N2CCC(N(C)C(=O)c3cnc(N4C[C@H](NC(=O)OC(C)(C)C)[C@@H](c5cc(F)c(F)cc5F)C4)nc3)CC2)n1 |
| InChI | InChI=1S/C30H37F3N8O4/c1-6-25-37-28(45-38-25)40-9-7-18(8-10-40)39(5)26(42)17-13-34-27(35-14-17)41-15-20(19-11-22(32)23(33)12-21(19)31)24(16-41)36-29(43)44-30(2,3)4/h11-14,18,20,24H,6-10,15-16H2,1-5H3,(H,36,43)/t20-,24+/m1/s1 |
| InChIKey | KAFXEWDQMXAELN-YKSBVNFPSA-N |
| XLogP | 4.08 |
| TPSA | 129.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.67 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|