C16H17NO3 — CID 71276444
5,5,7-trimethyl-8-oxo-7,9-dihydro-6H-carbazole-3-carboxylic acid (PubChem CID 71276444) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 5,5,7-trimethyl-8-oxo-7,9-dihydro-6H-carbazole-3-carboxylic acid.
| Compound Name | 5,5,7-trimethyl-8-oxo-7,9-dihydro-6H-carbazole-3-carboxylic acid |
|---|---|
| PubChem CID | 71276444 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 5,5,7-trimethyl-8-oxo-7,9-dihydro-6H-carbazole-3-carboxylic acid |
| SMILES | CC1CC(C)(C)c2c([nH]c3ccc(C(=O)O)cc23)C1=O |
| InChI | InChI=1S/C16H17NO3/c1-8-7-16(2,3)12-10-6-9(15(19)20)4-5-11(10)17-13(12)14(8)18/h4-6,8,17H,7H2,1-3H3,(H,19,20) |
| InChIKey | BYPKHTDDRNBEHS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |