C18H23NO7 — CID 71276705
trimethyl (1Z,6Z)-1,6-dimethyl-5-oxo-2,4,7,9-tetrahydrocyclopenta[d]azocine-3,8,8-tricarboxylate (PubChem CID 71276705) has the molecular formula C18H23NO7 and a molecular weight of 365.38 g/mol. Its IUPAC name is trimethyl (1Z,6Z)-1,6-dimethyl-5-oxo-2,4,7,9-tetrahydrocyclopenta[d]azocine-3,8,8-tricarboxylate.
| Compound Name | trimethyl (1Z,6Z)-1,6-dimethyl-5-oxo-2,4,7,9-tetrahydrocyclopenta[d]azocine-3,8,8-tricarboxylate |
|---|---|
| PubChem CID | 71276705 |
| Molecular Formula | C18H23NO7 |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | trimethyl (1Z,6Z)-1,6-dimethyl-5-oxo-2,4,7,9-tetrahydrocyclopenta[d]azocine-3,8,8-tricarboxylate |
| SMILES | COC(=O)N1CC(=O)/C(C)=C2/CC(C(=O)OC)(C(=O)OC)C/C2=C(\C)C1 |
| InChI | InChI=1S/C18H23NO7/c1-10-8-19(17(23)26-5)9-14(20)11(2)13-7-18(6-12(10)13,15(21)24-3)16(22)25-4/h6-9H2,1-5H3/b12-10-,13-11- |
| InChIKey | LBKINCNGZQOGDL-MIMPSMLTSA-N |
| XLogP | 1.40 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|